Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Thermo Scientific Chemicals Ethylenediaminetetraacetic acid, disodium salt dihydrate, 99+%, ACS reagent
CAS: 6381-92-6 Molecular Formula: C10H18N2Na2O10 Molecular Weight (g/mol): 372.24 MDL Number: MFCD00150037,MFCD00003541 InChI Key: OVBJJZOQPCKUOR-UHFFFAOYSA-L Synonym: edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs PubChem CID: 44120005 SMILES: O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O
| PubChem CID | 44120005 |
|---|---|
| CAS | 6381-92-6 |
| Molecular Weight (g/mol) | 372.24 |
| MDL Number | MFCD00150037,MFCD00003541 |
| SMILES | O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O |
| Synonym | edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs |
| InChI Key | OVBJJZOQPCKUOR-UHFFFAOYSA-L |
| Molecular Formula | C10H18N2Na2O10 |
Ethylenediamine, 99%
CAS: 107-15-3 Molecular Formula: C2H8N2 Molecular Weight (g/mol): 60.10 MDL Number: MFCD00008204 InChI Key: PIICEJLVQHRZGT-UHFFFAOYSA-N Synonym: ethylenediamine,1,2-ethanediamine,1,2-diaminoethane,ethylene diamine,ethylenediamine,dimethylenediamine,edamine,1,2-ethylenediamine,aethaldiamin,aethylenediamin PubChem CID: 3301 ChEBI: CHEBI:30347 IUPAC Name: ethane-1,2-diamine SMILES: NCCN
| PubChem CID | 3301 |
|---|---|
| CAS | 107-15-3 |
| Molecular Weight (g/mol) | 60.10 |
| ChEBI | CHEBI:30347 |
| MDL Number | MFCD00008204 |
| SMILES | NCCN |
| Synonym | ethylenediamine,1,2-ethanediamine,1,2-diaminoethane,ethylene diamine,ethylenediamine,dimethylenediamine,edamine,1,2-ethylenediamine,aethaldiamin,aethylenediamin |
| IUPAC Name | ethane-1,2-diamine |
| InChI Key | PIICEJLVQHRZGT-UHFFFAOYSA-N |
| Molecular Formula | C2H8N2 |
Benzophenone, 99+%, pure
CAS: 119-61-9 Molecular Formula: C13H10O Molecular Weight (g/mol): 182.22 InChI Key: RWCCWEUUXYIKHB-UHFFFAOYSA-N Synonym: benzophenone,diphenyl ketone,benzoylbenzene,phenyl ketone,methanone, diphenyl,alpha-oxoditane,ketone, diphenyl,benzene, benzoyl,alpha-oxodiphenylmethane,diphenylketone PubChem CID: 3102 ChEBI: CHEBI:41308 IUPAC Name: diphenylmethanone SMILES: C1=CC=C(C=C1)C(=O)C2=CC=CC=C2
| PubChem CID | 3102 |
|---|---|
| CAS | 119-61-9 |
| Molecular Weight (g/mol) | 182.22 |
| ChEBI | CHEBI:41308 |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC=CC=C2 |
| Synonym | benzophenone,diphenyl ketone,benzoylbenzene,phenyl ketone,methanone, diphenyl,alpha-oxoditane,ketone, diphenyl,benzene, benzoyl,alpha-oxodiphenylmethane,diphenylketone |
| IUPAC Name | diphenylmethanone |
| InChI Key | RWCCWEUUXYIKHB-UHFFFAOYSA-N |
| Molecular Formula | C13H10O |
2-Mercaptoethanol Cell Culture MP Biomedicals
CAS: 60-24-2 Molecular Formula: C2H6OS Molecular Weight (g/mol): 78.13 MDL Number: MFCD00004890 InChI Key: DGVVWUTYPXICAM-UHFFFAOYSA-N Synonym: 2-mercaptoethanol,mercaptoethanol,thioglycol,beta-mercaptoethanol,ethanol, 2-mercapto,2-thioethanol,2-hydroxy-1-ethanethiol,thioethylene glycol,2-hydroxyethanethiol,2-hydroxyethyl mercaptan PubChem CID: 1567 ChEBI: CHEBI:41218 IUPAC Name: 2-sulfanylethan-1-ol SMILES: OCCS
| PubChem CID | 1567 |
|---|---|
| CAS | 60-24-2 |
| Molecular Weight (g/mol) | 78.13 |
| ChEBI | CHEBI:41218 |
| MDL Number | MFCD00004890 |
| SMILES | OCCS |
| Synonym | 2-mercaptoethanol,mercaptoethanol,thioglycol,beta-mercaptoethanol,ethanol, 2-mercapto,2-thioethanol,2-hydroxy-1-ethanethiol,thioethylene glycol,2-hydroxyethanethiol,2-hydroxyethyl mercaptan |
| IUPAC Name | 2-sulfanylethan-1-ol |
| InChI Key | DGVVWUTYPXICAM-UHFFFAOYSA-N |
| Molecular Formula | C2H6OS |
2,6-Dichloroindophenol sodium salt hydrate
CAS: 1266615-56-8 Molecular Formula: C12H6Cl2NNaO2 Molecular Weight (g/mol): 290.07 MDL Number: MFCD00150014 InChI Key: FHLDWQLHDYCXKI-UHFFFAOYSA-M Synonym: 2,6-dichloroindophenol sodium salt,2,6-dichlorophenolindophenol sodium salt,tillman's reagent,tillman's reagenz,dichlorphenol-indophenolnatrium,2,6-dichloroindophenol sodium,unii-kad7q8xo1y,sodium 2,6-dichloroindophenol,sodium 2,6-dichloroindophenolate,2,6-dichloroindophenol, sodium salt PubChem CID: 23697355 ChEBI: CHEBI:948 IUPAC Name: sodium;4-[(3,5-dichloro-4-oxocyclohexa-2,5-dien-1-ylidene)amino]phenolate SMILES: [Na+].[O-]C1=C(Cl)C=C(C=C1Cl)N=C1C=CC(=O)C=C1
| PubChem CID | 23697355 |
|---|---|
| CAS | 1266615-56-8 |
| Molecular Weight (g/mol) | 290.07 |
| ChEBI | CHEBI:948 |
| MDL Number | MFCD00150014 |
| SMILES | [Na+].[O-]C1=C(Cl)C=C(C=C1Cl)N=C1C=CC(=O)C=C1 |
| Synonym | 2,6-dichloroindophenol sodium salt,2,6-dichlorophenolindophenol sodium salt,tillman's reagent,tillman's reagenz,dichlorphenol-indophenolnatrium,2,6-dichloroindophenol sodium,unii-kad7q8xo1y,sodium 2,6-dichloroindophenol,sodium 2,6-dichloroindophenolate,2,6-dichloroindophenol, sodium salt |
| IUPAC Name | sodium;4-[(3,5-dichloro-4-oxocyclohexa-2,5-dien-1-ylidene)amino]phenolate |
| InChI Key | FHLDWQLHDYCXKI-UHFFFAOYSA-M |
| Molecular Formula | C12H6Cl2NNaO2 |
Morpholine, 99%
CAS: 110-91-8 Molecular Formula: C4H9NO Molecular Weight (g/mol): 87.12 MDL Number: MFCD00005972 InChI Key: YNAVUWVOSKDBBP-UHFFFAOYSA-N Synonym: 1-oxa-4-azacyclohexane,tetrahydro-1,4-oxazine,diethylene oximide,diethylenimide oxide,diethyleneimide oxide,drewamine,diethylene imidoxide,tetrahydro-p-oxazine,tetrahydro-2h-1,4-oxazine,p-isoxazine, tetrahydro PubChem CID: 8083 ChEBI: CHEBI:34856 IUPAC Name: morpholine SMILES: C1COCCN1
| PubChem CID | 8083 |
|---|---|
| CAS | 110-91-8 |
| Molecular Weight (g/mol) | 87.12 |
| ChEBI | CHEBI:34856 |
| MDL Number | MFCD00005972 |
| SMILES | C1COCCN1 |
| Synonym | 1-oxa-4-azacyclohexane,tetrahydro-1,4-oxazine,diethylene oximide,diethylenimide oxide,diethyleneimide oxide,drewamine,diethylene imidoxide,tetrahydro-p-oxazine,tetrahydro-2h-1,4-oxazine,p-isoxazine, tetrahydro |
| IUPAC Name | morpholine |
| InChI Key | YNAVUWVOSKDBBP-UHFFFAOYSA-N |
| Molecular Formula | C4H9NO |
| Linear Formula | (CH3)2NH |
|---|---|
| ChEBI | CHEBI:17170 |
| InChI Key | ROSDSFDQCJNGOL-UHFFFAOYSA-N |
| PubChem CID | 674 |
| Percent Purity | ≥40% |
| Fieser | 07,119 |
| RTECS Number | IP8750000 |
| Formula Weight | 45.07 |
| Melting Point | -37.0°C |
| Boiling Point | 54.0°C |
| Color | Colorless |
| Physical Form | Liquid |
| Chemical Name or Material | Dimethylamine |
| SMILES | CNC |
| Merck Index | 15, 3250 |
| CAS | 7732-18-5 |
| Health Hazard 3 | GHS P Statement Keep away from heat/sparks/open flames/hot surfaces. - No smoking. Wear protective gloves/protective clothing/eye protection/face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove conta |
| MDL Number | MFCD00008288 |
| Health Hazard 2 | GHS H Statement Causes severe skin burns and eye damage. Harmful if inhaled. Harmful if swallowed. May cause respiratory irritation. Highly flammable liquid and vapor. |
| Health Hazard 1 | GHS Signal Word: Danger |
| Refractive Index | 1.37 |
| Synonym | dimethylamine,n,n-dimethylamine,methanamine, n-methyl,dimethylamin,dimethyl amine,dimethyl-amine,dimethylamine anhydrous,rcra waste number u092,dimethylamine solution |
| TSCA | TSCA |
| Beilstein | 04, 39 |
| EINECS Number | 204-697-4 |
| Specific Gravity | 0.89 |
| CAS | 9005-38-3 |
|---|---|
| Molecular Formula | (C6H7O7)A(C6H7O7)BNa |
Triethylamine, for HPLC
CAS: 121-44-8 Molecular Formula: C6H15N Molecular Weight (g/mol): 101.19 InChI Key: ZMANZCXQSJIPKH-UHFFFAOYSA-N Synonym: triethylamine,ethanamine, n,n-diethyl,diethylamino ethane,triaethylamin,triethylamin,trietilamina,triethyl amine,n,n,n-triethylamine,net3,diethylaminoethane PubChem CID: 8471 ChEBI: CHEBI:35026 IUPAC Name: N,N-diethylethanamine SMILES: CCN(CC)CC
| PubChem CID | 8471 |
|---|---|
| CAS | 121-44-8 |
| Molecular Weight (g/mol) | 101.19 |
| ChEBI | CHEBI:35026 |
| SMILES | CCN(CC)CC |
| Synonym | triethylamine,ethanamine, n,n-diethyl,diethylamino ethane,triaethylamin,triethylamin,trietilamina,triethyl amine,n,n,n-triethylamine,net3,diethylaminoethane |
| IUPAC Name | N,N-diethylethanamine |
| InChI Key | ZMANZCXQSJIPKH-UHFFFAOYSA-N |
| Molecular Formula | C6H15N |
1,10-Phenanthroline monohydrate, ACS
CAS: 5144-89-8 Molecular Formula: C12H10N2O Molecular Weight (g/mol): 198.23 MDL Number: MFCD00149973 InChI Key: PPQJCISYYXZCAE-UHFFFAOYSA-N Synonym: 1,10-phenanthroline hydrate,1,10-phenanthroline monohydrate,o-phenanthroline monohydrate,unii-ksx215x00e,1,10-fenantrolina,4,5-phenanthroline monohydrate,1,10-phenanthroline, monohydrate,1,10-fenanthrolin,1,10-phenanthrolineo-phenanthroline,1, 10-phenanthroline monohydrate PubChem CID: 21226 IUPAC Name: 1,10-phenanthroline;hydrate SMILES: O.C1=CN=C2C(C=CC3=CC=CN=C23)=C1
| PubChem CID | 21226 |
|---|---|
| CAS | 5144-89-8 |
| Molecular Weight (g/mol) | 198.23 |
| MDL Number | MFCD00149973 |
| SMILES | O.C1=CN=C2C(C=CC3=CC=CN=C23)=C1 |
| Synonym | 1,10-phenanthroline hydrate,1,10-phenanthroline monohydrate,o-phenanthroline monohydrate,unii-ksx215x00e,1,10-fenantrolina,4,5-phenanthroline monohydrate,1,10-phenanthroline, monohydrate,1,10-fenanthrolin,1,10-phenanthrolineo-phenanthroline,1, 10-phenanthroline monohydrate |
| IUPAC Name | 1,10-phenanthroline;hydrate |
| InChI Key | PPQJCISYYXZCAE-UHFFFAOYSA-N |
| Molecular Formula | C12H10N2O |
Tetraethylammonium bromide, 98%
CAS: 71-91-0 Molecular Formula: C8H20BrN Molecular Weight (g/mol): 210.159 MDL Number: MFCD00011825 InChI Key: HWCKGOZZJDHMNC-UHFFFAOYSA-M Synonym: tetraethylammonium bromide,teab,tea bromide,tetrylammonium bromide,sympatektoman,tetranium,etylon,bromethyl,beparon,etambro PubChem CID: 6285 IUPAC Name: tetraethylazanium;bromide SMILES: CC[N+](CC)(CC)CC.[Br-]
| PubChem CID | 6285 |
|---|---|
| CAS | 71-91-0 |
| Molecular Weight (g/mol) | 210.159 |
| MDL Number | MFCD00011825 |
| SMILES | CC[N+](CC)(CC)CC.[Br-] |
| Synonym | tetraethylammonium bromide,teab,tea bromide,tetrylammonium bromide,sympatektoman,tetranium,etylon,bromethyl,beparon,etambro |
| IUPAC Name | tetraethylazanium;bromide |
| InChI Key | HWCKGOZZJDHMNC-UHFFFAOYSA-M |
| Molecular Formula | C8H20BrN |
5-Sulfosalicylic acid dihydrate, ACS, 99+%
CAS: 5965-83-3 Molecular Formula: C9H14O6S Molecular Weight (g/mol): 250.27 MDL Number: MFCD00007508,MFCD00149540 InChI Key: NFYHZVWMQHQKRU-UHFFFAOYSA-N Synonym: 2-hydroxy-5-sulfobenzoic acid dihydrate,5-sulfosalicylic acid dihydrate,sulfosalicylic acid dihydrate,benzoic acid, 2-hydroxy-5-sulfo-, dihydrate,unii-09ngq462s6,2-hydroxy-5-sulfobenzoic acid, hydrate, hydrate,5-sulfosalicylsyre,5-sulfosalicylsaeure,salicylic acid, 5-sulfo-, dihydrate,acmc-1aymd PubChem CID: 2723734 IUPAC Name: 2-hydroxy-5-sulfobenzoic acid;dihydrate SMILES: C.C.OC(=O)C1=CC(=CC=C1O)S(O)(=O)=O
| PubChem CID | 2723734 |
|---|---|
| CAS | 5965-83-3 |
| Molecular Weight (g/mol) | 250.27 |
| MDL Number | MFCD00007508,MFCD00149540 |
| SMILES | C.C.OC(=O)C1=CC(=CC=C1O)S(O)(=O)=O |
| Synonym | 2-hydroxy-5-sulfobenzoic acid dihydrate,5-sulfosalicylic acid dihydrate,sulfosalicylic acid dihydrate,benzoic acid, 2-hydroxy-5-sulfo-, dihydrate,unii-09ngq462s6,2-hydroxy-5-sulfobenzoic acid, hydrate, hydrate,5-sulfosalicylsyre,5-sulfosalicylsaeure,salicylic acid, 5-sulfo-, dihydrate,acmc-1aymd |
| IUPAC Name | 2-hydroxy-5-sulfobenzoic acid;dihydrate |
| InChI Key | NFYHZVWMQHQKRU-UHFFFAOYSA-N |
| Molecular Formula | C9H14O6S |
Triphenylphosphine, 99%
CAS: 603-35-0 Molecular Formula: C18H15P Molecular Weight (g/mol): 262.29 MDL Number: MFCD00003043 MFCD20489348 InChI Key: RIOQSEWOXXDEQQ-UHFFFAOYSA-N Synonym: triphenylphosphine,triphenyl phosphine,phosphine, triphenyl,triphenylphosphorus,triphenyl-phosphane,triphenylphosphide,phosphorustriphenyl,trifenylfosfin,trifenylfosfin czech,triphenylphosphine resin PubChem CID: 11776 IUPAC Name: triphenylphosphane SMILES: C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 11776 |
|---|---|
| CAS | 603-35-0 |
| Molecular Weight (g/mol) | 262.29 |
| MDL Number | MFCD00003043 MFCD20489348 |
| SMILES | C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | triphenylphosphine,triphenyl phosphine,phosphine, triphenyl,triphenylphosphorus,triphenyl-phosphane,triphenylphosphide,phosphorustriphenyl,trifenylfosfin,trifenylfosfin czech,triphenylphosphine resin |
| IUPAC Name | triphenylphosphane |
| InChI Key | RIOQSEWOXXDEQQ-UHFFFAOYSA-N |
| Molecular Formula | C18H15P |
Thermo Scientific Chemicals D-Cycloserine, 98%
CAS: 68-41-7 Molecular Formula: C3H6N2O2 Molecular Weight (g/mol): 102.09 MDL Number: MFCD00005353 InChI Key: DYDCUQKUCUHJBH-UWTATZPHSA-N Synonym: d-cycloserine,cycloserine,seromycin,orientomycin,oxamycin,cyclorin,cyclo-d-serine,cicloserina,farmiserina,miroseryn PubChem CID: 6234 ChEBI: CHEBI:40009 IUPAC Name: (4R)-4-amino-1,2-oxazolidin-3-one SMILES: C1C(C(=O)NO1)N
| PubChem CID | 6234 |
|---|---|
| CAS | 68-41-7 |
| Molecular Weight (g/mol) | 102.09 |
| ChEBI | CHEBI:40009 |
| MDL Number | MFCD00005353 |
| SMILES | C1C(C(=O)NO1)N |
| Synonym | d-cycloserine,cycloserine,seromycin,orientomycin,oxamycin,cyclorin,cyclo-d-serine,cicloserina,farmiserina,miroseryn |
| IUPAC Name | (4R)-4-amino-1,2-oxazolidin-3-one |
| InChI Key | DYDCUQKUCUHJBH-UWTATZPHSA-N |
| Molecular Formula | C3H6N2O2 |
Acetylsalicylic acid, 99%, Thermo Scientific Chemicals
CAS: 50-78-2 Molecular Formula: C9H8O4 Molecular Weight (g/mol): 180.16 MDL Number: MFCD00002430 InChI Key: BSYNRYMUTXBXSQ-UHFFFAOYSA-N Synonym: aspirin,acetylsalicylic acid,2-acetoxybenzoic acid,2-acetyloxy benzoic acid,acetylsalicylate,o-acetylsalicylic acid,o-acetoxybenzoic acid,acylpyrin,polopiryna,easprin PubChem CID: 2244 ChEBI: CHEBI:15365 IUPAC Name: 2-acetyloxybenzoic acid SMILES: CC(=O)OC1=CC=CC=C1C(O)=O
| PubChem CID | 2244 |
|---|---|
| CAS | 50-78-2 |
| Molecular Weight (g/mol) | 180.16 |
| ChEBI | CHEBI:15365 |
| MDL Number | MFCD00002430 |
| SMILES | CC(=O)OC1=CC=CC=C1C(O)=O |
| Synonym | aspirin,acetylsalicylic acid,2-acetoxybenzoic acid,2-acetyloxy benzoic acid,acetylsalicylate,o-acetylsalicylic acid,o-acetoxybenzoic acid,acylpyrin,polopiryna,easprin |
| IUPAC Name | 2-acetyloxybenzoic acid |
| InChI Key | BSYNRYMUTXBXSQ-UHFFFAOYSA-N |
| Molecular Formula | C9H8O4 |